![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | 123.jpg | 2020-11-17 14:58 | 254K | |
![[IMG]](/icons/image2.gif) | Application form & land recor.jpg | 2020-11-17 14:58 | 30K | |
![[VID]](/icons/movie.gif) | Azolla.flv | 2020-11-17 14:57 | 5.2M | |
![[VID]](/icons/movie.gif) | Azolla.wmv | 2020-11-17 14:57 | 9.5M | |
![[IMG]](/icons/image2.gif) | Azolla Biofertilizer technology booklet.jpg | 2020-11-17 14:57 | 2.6M | |
![[IMG]](/icons/image2.gif) | BGA.jpg | 2020-11-17 14:58 | 1.3M | |
![[IMG]](/icons/image2.gif) | Basket-Fruit.jpg | 2020-11-17 14:57 | 169K | |
![[IMG]](/icons/image2.gif) | Biofertilizers1.jpg | 2020-11-17 14:58 | 352K | |
![[ ]](/icons/unknown.gif) | Clear_Skin_3.swf | 2020-11-17 14:57 | 7.6K | |
![[IMG]](/icons/image2.gif) | Compost+vermi.jpg | 2020-11-17 14:57 | 1.6M | |
![[IMG]](/icons/image2.gif) | Compostin g of staw waste.jpg | 2020-11-17 14:58 | 339K | |
![[IMG]](/icons/image2.gif) | Download TNOCD Standards.jpg | 2020-11-17 14:58 | 29K | |
![[IMG]](/icons/image2.gif) | Download application forms.jpg | 2020-11-17 14:57 | 56K | |
![[ ]](/icons/layout.gif) | FEE STRUCTURE.pdf | 2020-11-17 14:57 | 9.3K | |
![[ ]](/icons/unknown.gif) | FLVPlayer_Progressive.swf | 2020-11-17 14:57 | 9.1K | |
![[ ]](/icons/layout.gif) | FORM-1A.pdf | 2020-11-17 14:57 | 41K | |
![[ ]](/icons/layout.gif) | FORM-1D.pdf | 2020-11-17 14:57 | 11K | |
![[ ]](/icons/layout.gif) | FORM-11.pdf | 2020-11-17 14:57 | 9.3K | |
![[ ]](/icons/layout.gif) | GeneralschemeformOF.pdf | 2020-11-17 14:58 | 35K | |
![[IMG]](/icons/image2.gif) | Green manure.JPG | 2020-11-17 14:57 | 25K | |
![[IMG]](/icons/image2.gif) | INTRODUCTION.jpg | 2020-11-17 14:57 | 82K | |
![[ ]](/icons/layout.gif) | IPM Booklet for OF-Dr.P.D.pdf | 2020-11-17 14:57 | 1.1M | |
![[ ]](/icons/layout.gif) | Land Record.pdf | 2020-11-17 14:57 | 43K | |
![[ ]](/icons/layout.gif) | LandRecord.pdf | 2020-11-17 14:57 | 43K | |
![[IMG]](/icons/image2.gif) | MODEL 2.jpg | 2020-11-17 14:57 | 331K | |
![[IMG]](/icons/image2.gif) | MODEL 3.jpg | 2020-11-17 14:58 | 190K | |
![[IMG]](/icons/image2.gif) | OFoverview.jpg | 2020-11-17 14:57 | 2.3M | |
![[ ]](/icons/unknown.gif) | Organic Agriculture in India - APEDA.mht | 2020-11-17 14:58 | 41K | |
![[ ]](/icons/unknown.gif) | Organic Farming.pptx | 2020-11-17 14:57 | 62K | |
![[IMG]](/icons/image2.gif) | Panama Disease.JPG | 2020-11-17 14:57 | 42K | |
![[DIR]](/icons/folder.gif) | Scripts/ | 2020-11-18 11:21 | - | |
![[ ]](/icons/layout.gif) | TNOCD STANDARDS.pdf | 2020-11-17 14:57 | 146K | |
![[IMG]](/icons/image2.gif) | TNOCD_1.jpg | 2020-11-17 14:58 | 1.5M | |
![[IMG]](/icons/image2.gif) | TNOCD_2.jpg | 2020-11-17 14:57 | 1.8M | |
![[IMG]](/icons/image2.gif) | TNOCD_2.tif | 2020-11-17 14:57 | 5.7M | |
![[IMG]](/icons/image2.gif) | TNOCD_3.jpg | 2020-11-17 14:57 | 1.7M | |
![[IMG]](/icons/image2.gif) | TNOCD_3.tif | 2020-11-17 14:57 | 5.0M | |
![[IMG]](/icons/image2.gif) | TNOCD_4.jpg | 2020-11-17 14:57 | 2.5M | |
![[IMG]](/icons/image2.gif) | TNOCD_4.tif | 2020-11-17 14:57 | 7.6M | |
![[IMG]](/icons/image2.gif) | TNOCD_5.jpg | 2020-11-17 14:57 | 3.2M | |
![[IMG]](/icons/image2.gif) | TNOCD_6.jpg | 2020-11-17 14:57 | 2.7M | |
![[ ]](/icons/unknown.gif) | Thumbs.db | 2020-11-17 14:57 | 2.3M | |
![[IMG]](/icons/image2.gif) | TomatoFusariumWilt.jpg | 2020-11-17 14:57 | 74K | |
![[ ]](/icons/layout.gif) | URF Technology_tamil.pdf | 2020-11-17 14:58 | 9.2M | |
![[IMG]](/icons/image2.gif) | Untitled-1.jpg | 2020-11-17 14:57 | 325K | |
![[IMG]](/icons/image2.gif) | Untitled-2.jpg | 2020-11-17 14:57 | 328K | |
![[IMG]](/icons/image2.gif) | Untitled-3 copy.jpg | 2020-11-17 14:57 | 347K | |
![[DIR]](/icons/folder.gif) | _notes/ | 2020-11-18 11:21 | - | |
![[IMG]](/icons/image2.gif) | accreditation_tnocd.jpg | 2020-11-17 14:58 | 31K | |
![[IMG]](/icons/image2.gif) | agri_majareas_greenleafmanure copy.jpg | 2020-11-17 14:58 | 244K | |
![[IMG]](/icons/image2.gif) | apple leafscab.jpg | 2020-11-17 14:57 | 39K | |
![[IMG]](/icons/image2.gif) | applescab.jpg | 2020-11-17 14:58 | 54K | |
![[IMG]](/icons/image2.gif) | azolla.jpg | 2020-11-17 14:57 | 22K | |
![[IMG]](/icons/image2.gif) | biofertilizers.jpg | 2020-11-17 14:57 | 34K | |
![[IMG]](/icons/image2.gif) | biofertilizers2.jpg | 2020-11-17 14:57 | 2.7M | |
![[IMG]](/icons/image2.gif) | blacl polythene mulch copy.jpg | 2020-11-17 14:57 | 48K | |
![[IMG]](/icons/image2.gif) | chry_SeptoriaLeafSpot112.jpg | 2020-11-17 14:57 | 36K | |
![[IMG]](/icons/image2.gif) | chry_powderymildew.jpg | 2020-11-17 14:57 | 14K | |
![[IMG]](/icons/image2.gif) | chrys_white_rustx800.jpg | 2020-11-17 14:57 | 67K | |
![[IMG]](/icons/image2.gif) | citrus gummosis.jpg | 2020-11-17 14:57 | 14K | |
![[IMG]](/icons/image2.gif) | collage1.png | 2020-11-17 14:57 | 1.3M | |
![[IMG]](/icons/image2.gif) | competive weeds.jpg | 2020-11-17 14:57 | 59K | |
![[IMG]](/icons/image2.gif) | compost.jpg | 2020-11-17 14:57 | 81K | |
![[IMG]](/icons/image2.gif) | compost bookletens.jpg | 2020-11-17 14:58 | 1.2M | |
![[IMG]](/icons/image2.gif) | compost tamill.jpg | 2020-11-17 14:57 | 3.1M | |
![[IMG]](/icons/image2.gif) | dasakavya plants.jpg | 2020-11-17 14:57 | 96K | |
![[IMG]](/icons/image2.gif) | drselvrajbookletonof.jpg | 2020-11-17 14:57 | 3.5M | |
![[IMG]](/icons/image2.gif) | drselvrajbookletonof.tif | 2020-11-17 14:57 | 7.0M | |
![[IMG]](/icons/image2.gif) | earthworm.jpg | 2020-11-17 14:57 | 31K | |
![[IMG]](/icons/image2.gif) | em.jpg | 2020-11-17 14:57 | 19K | |
![[IMG]](/icons/image2.gif) | faq.jpg | 2020-11-17 14:57 | 7.4K | |
![[DIR]](/icons/folder.gif) | farmer_experiences_images/ | 2020-11-18 11:21 | - | |
![[IMG]](/icons/image2.gif) | fusarium_wilt_race3.jpg | 2020-11-17 14:57 | 136K | |
![[IMG]](/icons/image2.gif) | gph.jpg | 2020-11-17 14:58 | 28K | |
![[IMG]](/icons/image2.gif) | green-ball-icone-7505-96.png | 2020-11-17 14:57 | 9.7K | |
![[IMG]](/icons/image2.gif) | green_leaf.png | 2020-11-17 14:57 | 514K | |
![[IMG]](/icons/image2.gif) | green_mannure.png | 2020-11-17 14:57 | 417K | |
![[IMG]](/icons/image2.gif) | greenleafmanure.jpg | 2020-11-17 14:57 | 64K | |
![[IMG]](/icons/image2.gif) | harvesting.jpg | 2020-11-17 14:57 | 24K | |
![[DIR]](/icons/folder.gif) | images/ | 2025-02-25 10:56 | - | |
![[TXT]](/icons/text.gif) | important_gos2012_ta.html | 2020-11-17 14:57 | 28K | |
![[IMG]](/icons/image2.gif) | ingrdients.jpg | 2020-11-17 14:57 | 73K | |
![[IMG]](/icons/image2.gif) | ingredients PANCHAKAVYA.jpg | 2020-11-17 14:58 | 52K | |
![[IMG]](/icons/image2.gif) | ipm.jpg | 2020-11-17 14:57 | 137K | |
![[IMG]](/icons/image2.gif) | ipm booklet.jpg | 2020-11-17 14:57 | 2.4M | |
![[IMG]](/icons/image2.gif) | littleleaf.jpg | 2020-11-17 14:57 | 35K | |
![[ ]](/icons/unknown.gif) | mm_menu.js | 2020-11-17 14:57 | 30K | |
![[TXT]](/icons/text.gif) | model.html | 2020-11-17 14:57 | 7.8K | |
![[IMG]](/icons/image2.gif) | mycorrhizal biofertilizer.jpg | 2020-11-17 14:58 | 32K | |
![[IMG]](/icons/image2.gif) | new.gif | 2023-03-14 14:40 | 1.2K | |
![[IMG]](/icons/image2.gif) | org_agrimain.jpg | 2020-11-17 14:57 | 105K | |
![[IMG]](/icons/image2.gif) | org_farm.jpg | 2020-11-17 14:58 | 50K | |
![[IMG]](/icons/image2.gif) | org_hortmain.jpg | 2020-11-17 14:57 | 287K | |
![[IMG]](/icons/image2.gif) | org_hortmain2.jpg | 2020-11-17 14:57 | 331K | |
![[IMG]](/icons/image2.gif) | org_model2 2.jpg | 2020-11-17 14:58 | 254K | |
![[IMG]](/icons/image2.gif) | organic acidlime.jpg | 2020-11-17 14:57 | 16K | |
![[IMG]](/icons/image2.gif) | organic banana.jpg | 2020-11-17 14:57 | 12K | |
![[IMG]](/icons/image2.gif) | organic guva.jpg | 2020-11-17 14:57 | 14K | |
![[IMG]](/icons/image2.gif) | organic mango.jpg | 2020-11-17 14:57 | 16K | |
![[IMG]](/icons/image2.gif) | organic seedlings.jpg | 2020-11-17 14:57 | 9.3K | |
![[IMG]](/icons/image2.gif) | organic turmeric.jpg | 2020-11-17 14:58 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_agridiseases.html | 2020-11-17 14:57 | 218K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image002.jpg | 2020-11-17 14:58 | 2.1K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image002_0000.jpg | 2020-11-17 14:57 | 2.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image002_0001.jpg | 2020-11-17 14:57 | 9.7K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image002_0002.jpg | 2020-11-17 14:57 | 3.7K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image002_0003.jpg | 2020-11-17 14:57 | 6.2K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image002_0004.jpg | 2020-11-17 14:57 | 6.2K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image002_0005.jpg | 2020-11-17 14:57 | 8.6K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image004.jpg | 2020-11-17 14:57 | 2.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image004_0000.jpg | 2020-11-17 14:57 | 8.8K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image004_0001.jpg | 2020-11-17 14:57 | 7.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image004_0002.jpg | 2020-11-17 14:58 | 8.6K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image006.jpg | 2020-11-17 14:58 | 4.4K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image006_0000.jpg | 2020-11-17 14:57 | 9.3K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image006_0001.jpg | 2020-11-17 14:57 | 4.3K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image006_0002.jpg | 2020-11-17 14:57 | 8.6K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image008.jpg | 2020-11-17 14:58 | 3.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image008_0000.jpg | 2020-11-17 14:58 | 10K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image008_0001.jpg | 2020-11-17 14:58 | 4.4K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image008_0002.jpg | 2020-11-17 14:58 | 8.1K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image009.jpg | 2020-11-17 14:57 | 5.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image010.jpg | 2020-11-17 14:57 | 3.9K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image010_0000.jpg | 2020-11-17 14:57 | 7.1K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image011.jpg | 2020-11-17 14:57 | 16K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image012.jpg | 2020-11-17 14:57 | 5.7K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image013.jpg | 2020-11-17 14:57 | 3.4K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image014.jpg | 2020-11-17 14:58 | 6.4K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image015.jpg | 2020-11-17 14:58 | 2.8K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image017.jpg | 2020-11-17 14:57 | 3.3K | |
![[IMG]](/icons/image2.gif) | orgfarm_agridiseases_clip_image019.jpg | 2020-11-17 14:58 | 2.9K | |
![[TXT]](/icons/text.gif) | orgfarm_agridiseases_ta.html | 2020-11-17 14:58 | 282K | |
![[TXT]](/icons/text.gif) | orgfarm_agripest.html | 2020-11-17 14:57 | 51K | |
![[TXT]](/icons/text.gif) | orgfarm_agripest_ta.html | 2020-11-17 14:57 | 42K | |
![[TXT]](/icons/text.gif) | orgfarm_basic steps.html | 2020-11-17 14:57 | 14K | |
![[TXT]](/icons/text.gif) | orgfarm_basic steps_ta.html | 2020-11-17 14:58 | 5.6K | |
![[IMG]](/icons/image2.gif) | orgfarm_biodynamic farming_clip_image002.jpg | 2020-11-17 14:57 | 22K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic.html | 2020-11-17 14:58 | 61K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_Brinjal & Tomato_ta.html | 2020-11-17 14:57 | 23K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_banana_ta-1.html | 2020-11-17 14:58 | 49K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_banana_ta.html | 2020-11-17 14:58 | 48K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_calender_ta.html | 2020-11-17 14:57 | 23K | |
![[IMG]](/icons/image2.gif) | orgfarm_biodynmic_clip_image001.jpg | 2020-11-17 14:57 | 22K | |
![[IMG]](/icons/image2.gif) | orgfarm_biodynmic_clip_image001_0000.jpg | 2020-11-17 14:57 | 22K | |
![[IMG]](/icons/image2.gif) | orgfarm_biodynmic_clip_image001_0001.jpg | 2020-11-17 14:58 | 22K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_intro_ta.html | 2020-11-17 14:57 | 42K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_paddy_ta.html | 2020-11-17 14:57 | 39K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_prep500_ta.html | 2020-11-17 14:58 | 16K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_prep501_ta.html | 2020-11-17 14:57 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_prep502_ta.html | 2020-11-17 14:57 | 9.9K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_prep503_ta.html | 2020-11-17 14:57 | 9.6K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_prep504_ta.html | 2020-11-17 14:57 | 8.2K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_prep505_ta.html | 2020-11-17 14:57 | 8.5K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_prep506_ta.html | 2020-11-17 14:57 | 8.8K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_prep507_ta.html | 2020-11-17 14:58 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_prep508_ta.html | 2020-11-17 14:58 | 7.3K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_rice_ta.html | 2020-11-17 14:58 | 45K | |
![[TXT]](/icons/text.gif) | orgfarm_biodynmic_ta.html | 2020-11-17 14:57 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_biofertilizers.html | 2020-11-17 14:57 | 19K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizers_clip_image002_0000.jpg | 2020-11-17 14:58 | 9.2K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizers_clip_image004_0000.jpg | 2020-11-17 14:58 | 11K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizers_clip_image008.jpg | 2020-11-17 14:58 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_biofertilizers_ta.html | 2020-11-17 14:57 | 17K | |
![[TXT]](/icons/text.gif) | orgfarm_biofertilizertechnology.html | 2020-11-17 14:57 | 178K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image002.jpg | 2020-11-17 14:58 | 5.3K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image002_0000.jpg | 2020-11-17 14:57 | 8.9K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image002_0001.jpg | 2020-11-17 14:57 | 4.1K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image002_0002.jpg | 2020-11-17 14:57 | 3.9K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image002_0003.jpg | 2020-11-17 14:57 | 11K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image002_0004.jpg | 2020-11-17 14:58 | 11K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image002_0005.jpg | 2020-11-17 14:57 | 15K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image002_0006.jpg | 2020-11-17 14:58 | 15K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image002_0007.jpg | 2020-11-17 14:58 | 5.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image002_0008.jpg | 2020-11-17 14:57 | 7.8K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image003.gif | 2020-11-17 14:58 | 421 | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image004.jpg | 2020-11-17 14:57 | 4.4K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image004_0000.jpg | 2020-11-17 14:57 | 5.1K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image004_0001.jpg | 2020-11-17 14:57 | 7.7K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image004_0002.jpg | 2020-11-17 14:58 | 12K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image004_0003.jpg | 2020-11-17 14:57 | 12K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image005.jpg | 2020-11-17 14:58 | 4.9K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image006.jpg | 2020-11-17 14:57 | 9.3K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image006_0000.jpg | 2020-11-17 14:57 | 6.1K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image006_0001.jpg | 2020-11-17 14:57 | 6.3K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image006_0002.jpg | 2020-11-17 14:58 | 5.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image006_0003.jpg | 2020-11-17 14:57 | 4.8K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image006_0004.jpg | 2020-11-17 14:57 | 7.1K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image008.jpg | 2020-11-17 14:57 | 5.8K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image008_0000.jpg | 2020-11-17 14:57 | 6.1K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image008_0001.jpg | 2020-11-17 14:57 | 5.4K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image008_0002.jpg | 2020-11-17 14:58 | 6.6K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image008_0003.jpg | 2020-11-17 14:57 | 7.2K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image008_0004.jpg | 2020-11-17 14:57 | 27K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image009.gif | 2020-11-17 14:57 | 635 | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image010.jpg | 2020-11-17 14:57 | 9.7K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image010_0000.jpg | 2020-11-17 14:57 | 7.6K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image010_0001.jpg | 2020-11-17 14:58 | 5.3K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image010_0002.jpg | 2020-11-17 14:58 | 12K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image010_0003.jpg | 2020-11-17 14:58 | 35K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image011.jpg | 2020-11-17 14:57 | 6.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image012.jpg | 2020-11-17 14:57 | 10K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image012_0000.jpg | 2020-11-17 14:57 | 7.8K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image012_0001.jpg | 2020-11-17 14:58 | 12K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image012_0002.jpg | 2020-11-17 14:57 | 27K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image014.jpg | 2020-11-17 14:58 | 8.8K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image014_0000.jpg | 2020-11-17 14:57 | 16K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image014_0001.jpg | 2020-11-17 14:57 | 10K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image014_0002.jpg | 2020-11-17 14:58 | 21K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image016.jpg | 2020-11-17 14:57 | 4.3K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image016_0000.jpg | 2020-11-17 14:57 | 21K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image018.jpg | 2020-11-17 14:57 | 8.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image018_0000.jpg | 2020-11-17 14:57 | 17K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image020.jpg | 2020-11-17 14:57 | 26K | |
![[IMG]](/icons/image2.gif) | orgfarm_biofertilizertechnology_clip_image022.jpg | 2020-11-17 14:58 | 26K | |
![[TXT]](/icons/text.gif) | orgfarm_biofertilizertechnology_ta.html | 2025-04-01 09:13 | 274K | |
![[TXT]](/icons/text.gif) | orgfarm_cabbage.html | 2020-11-17 14:57 | 22K | |
![[TXT]](/icons/text.gif) | orgfarm_cabbage_ta.html | 2020-11-17 14:57 | 17K | |
![[TXT]](/icons/text.gif) | orgfarm_cardamom.html | 2020-11-17 14:57 | 23K | |
![[TXT]](/icons/text.gif) | orgfarm_cardomom_ta.html | 2020-11-17 14:57 | 21K | |
![[TXT]](/icons/text.gif) | orgfarm_carnation.html | 2020-11-17 14:57 | 29K | |
![[TXT]](/icons/text.gif) | orgfarm_carnation_ta.html | 2020-11-17 14:57 | 38K | |
![[TXT]](/icons/text.gif) | orgfarm_carrot.html | 2020-11-17 14:58 | 19K | |
![[TXT]](/icons/text.gif) | orgfarm_carrot_ta.html | 2020-11-17 14:57 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_certification_ta.html | 2024-07-09 14:35 | 8.1K | |
![[TXT]](/icons/text.gif) | orgfarm_coircompost.html | 2020-11-17 14:57 | 30K | |
![[IMG]](/icons/image2.gif) | orgfarm_coircompost_clip_image002.jpg | 2020-11-17 14:57 | 9.8K | |
![[TXT]](/icons/text.gif) | orgfarm_coircompost_ta.html | 2024-06-22 12:28 | 31K | |
![[IMG]](/icons/image2.gif) | orgfarm_coircompost_ta_clip_image001.jpg | 2020-11-17 14:57 | 9.8K | |
![[IMG]](/icons/image2.gif) | orgfarm_coircompost_ta_clip_image003.jpg | 2020-11-17 14:57 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_compost.html | 2020-11-17 14:57 | 16K | |
![[TXT]](/icons/text.gif) | orgfarm_compost_index_ta.html | 2024-06-22 12:28 | 6.5K | |
![[TXT]](/icons/text.gif) | orgfarm_compost_ta.html | 2020-11-17 14:57 | 17K | |
![[TXT]](/icons/text.gif) | orgfarm_compost_tech_ta.html | 2024-07-09 14:35 | 5.5K | |
![[TXT]](/icons/text.gif) | orgfarm_composting.html | 2020-11-17 14:57 | 84K | |
![[TXT]](/icons/text.gif) | orgfarm_composting_ta.html | 2024-06-22 12:28 | 97K | |
![[TXT]](/icons/text.gif) | orgfarm_constraints of OA.html | 2020-11-17 14:58 | 15K | |
![[TXT]](/icons/text.gif) | orgfarm_contacts_ta.html | 2020-11-17 14:57 | 6.4K | |
![[TXT]](/icons/text.gif) | orgfarm_cotton.html | 2020-11-17 14:57 | 32K | |
![[IMG]](/icons/image2.gif) | orgfarm_cotton_clip_image002.jpg | 2020-11-17 14:58 | 4.9K | |
![[TXT]](/icons/text.gif) | orgfarm_cotton_ta.html | 2020-11-17 14:58 | 45K | |
![[TXT]](/icons/text.gif) | orgfarm_crop_rotation_ta.html | 2020-11-17 14:57 | 16K | |
![[TXT]](/icons/text.gif) | orgfarm_crop_ta.html | 2024-06-22 12:28 | 41K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_ET5_ta.html | 2020-11-17 14:58 | 8.2K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_ET_ta.html | 2020-11-17 14:57 | 7.8K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_MEM_ta.html | 2020-11-17 14:58 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_TFPE_ta.html | 2020-11-17 14:57 | 8.9K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_TTCU_ta.html | 2020-11-17 14:58 | 6.2K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_amudham_ta.html | 2020-11-17 14:57 | 7.5K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_arappu_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_archeabacterial_ta.html | 2020-11-17 14:57 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_coconut_ta.html | 2020-11-17 14:57 | 8.2K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_concentrated_amudham_ta.html | 2020-11-17 14:57 | 7.0K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_disease_prevention_bacteria_ta.html | 2020-11-17 14:57 | 6.3K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_disease_prevention_blast_ta.html | 2020-11-17 14:57 | 6.5K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_disease_prevention_fungal_ta.html | 2020-11-17 14:58 | 8.1K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_disease_prevention_powdery_mildew_ta.html | 2020-11-17 14:58 | 8.0K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_disease_prevention_ta.html | 2020-11-17 14:58 | 6.2K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_efficient_micro_ta.html | 2020-11-17 14:57 | 7.6K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_eggextract_ta.html | 2020-11-17 14:57 | 7.0K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_fishextract_ta.html | 2020-11-17 14:57 | 7.9K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_fruit_gaudi_ta.html | 2020-11-17 14:57 | 24K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_panchakavya_ta.html | 2020-11-17 14:57 | 9.1K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_pest_repellants_control_larva_ta.html | 2020-11-17 14:57 | 9.2K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_pest_repellants_control_mites_ta.html | 2020-11-17 14:57 | 8.1K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_pest_repellants_ta.html | 2020-11-17 14:57 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_cropproduction_plantprotection_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_dasakavya.html | 2020-11-17 14:58 | 17K | |
![[TXT]](/icons/text.gif) | orgfarm_dasakavya_ta.html | 2024-06-25 14:44 | 14K | |
![[TXT]](/icons/text.gif) | orgfarm_effective microorganism.html | 2020-11-17 14:57 | 33K | |
![[TXT]](/icons/text.gif) | orgfarm_effective microorganism_ta.html | 2020-11-17 14:58 | 48K | |
![[TXT]](/icons/text.gif) | orgfarm_exporters.html | 2020-11-17 14:57 | 51K | |
![[TXT]](/icons/text.gif) | orgfarm_exporters_ta.html | 2020-11-17 14:58 | 64K | |
![[IMG]](/icons/image2.gif) | orgfarm_faq's - Copy_clip_image001.jpg | 2020-11-17 14:58 | 13K | |
![[IMG]](/icons/image2.gif) | orgfarm_faq's - Copy_clip_image001_0000.jpg | 2020-11-17 14:58 | 27K | |
![[IMG]](/icons/image2.gif) | orgfarm_faq's - Copy_clip_image002.jpg | 2020-11-17 14:58 | 24K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's.html | 2020-11-17 14:57 | 133K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_bioferti1_ta.html | 2020-11-17 14:57 | 9.0K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_bioferti2_ta.html | 2020-11-17 14:58 | 9.7K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_bioferti3_ta.html | 2020-11-17 14:57 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_bioferti4_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_bioferti5_ta.html | 2020-11-17 14:57 | 9.0K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_bioferti6_ta.html | 2020-11-17 14:57 | 8.1K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_bioferti7_ta.html | 2020-11-17 14:58 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_bioferti8_ta.html | 2020-11-17 14:58 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_bioferti9_ta.html | 2020-11-17 14:57 | 9.0K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_bioferti10_ta.html | 2020-11-17 14:58 | 6.6K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_certificate1_ta.html | 2020-11-17 14:58 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_certificate2_ta.html | 2020-11-17 14:57 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_certificate3_ta.html | 2020-11-17 14:57 | 9.8K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_certificate4_ta.html | 2020-11-17 14:58 | 9.4K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_certificate5_ta.html | 2020-11-17 14:57 | 11K | |
![[IMG]](/icons/image2.gif) | orgfarm_faq's_clip_image001.jpg | 2020-11-17 14:57 | 13K | |
![[IMG]](/icons/image2.gif) | orgfarm_faq's_clip_image001_0000.jpg | 2020-11-17 14:57 | 27K | |
![[IMG]](/icons/image2.gif) | orgfarm_faq's_clip_image002.jpg | 2020-11-17 14:57 | 24K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost1_ta.html | 2020-11-17 14:57 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost2_ta.html | 2020-11-17 14:57 | 9.4K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost3_ta.html | 2020-11-17 14:58 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost4_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost5_ta.html | 2020-11-17 14:57 | 12K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost6_ta.html | 2020-11-17 14:57 | 9.8K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost7_ta.html | 2020-11-17 14:57 | 9.1K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost8_ta.html | 2020-11-17 14:57 | 9.8K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost9_ta.html | 2020-11-17 14:58 | 8.5K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost10_ta.html | 2020-11-17 14:58 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost11_ta.html | 2020-11-17 14:57 | 9.5K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost12_ta.html | 2020-11-17 14:58 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost13_ta.html | 2020-11-17 14:57 | 14K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost14_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_compost15_ta.html | 2020-11-17 14:57 | 12K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_green_ta.html | 2020-11-17 14:57 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_organic_ta.html | 2020-11-17 14:57 | 9.8K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other1_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other2_ta.html | 2020-11-17 14:57 | 12K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other3_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other4_ta.html | 2020-11-17 14:57 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other5_ta.html | 2020-11-17 14:57 | 12K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other6_ta.html | 2020-11-17 14:57 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other7_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other8_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other9_ta.html | 2020-11-17 14:57 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other10_ta.html | 2020-11-17 14:58 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other11_ta.html | 2020-11-17 14:58 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other12_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_other13_ta.html | 2020-11-17 14:57 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_ta.html | 2024-07-09 14:35 | 6.9K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_vermi1_ta.html | 2020-11-17 14:57 | 12K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_vermi2_ta.html | 2020-11-17 14:58 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_vermi3_ta.html | 2020-11-17 14:57 | 12K | |
![[TXT]](/icons/text.gif) | orgfarm_faq's_vermi4_ta.html | 2020-11-17 14:58 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_club_ta.html | 2024-07-09 14:35 | 5.5K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_club_tn_ta.html | 2020-11-17 14:58 | 4.9K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_doc_pgs_ani_ta.html | 2020-11-17 14:57 | 14K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_doc_pgs_bee_ta.html | 2020-11-17 14:57 | 6.7K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_doc_pgs_crop_ta.html | 2020-11-17 14:57 | 14K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_doc_pgs_food_ta.html | 2020-11-17 14:57 | 15K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_doc_pgs_grl_ta.html | 2020-11-17 14:57 | 15K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_doc_pgs_ta.html | 2020-11-17 14:58 | 8.6K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_doc_ta.html | 2024-07-09 14:35 | 6.2K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_needs_ta.html | 2020-11-17 14:57 | 9.1K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_practices_ta.html | 2024-08-27 16:15 | 7.3K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_practices_treatment_bot_ta.html | 2020-11-17 14:57 | 16K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_practices_treatment_crop_cereals_ta.html | 2020-11-17 14:57 | 4.3K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_practices_treatment_crop_millets_ta.html | 2020-11-17 14:57 | 9.5K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_practices_treatment_crop_oilseeds_ta.html | 2020-11-17 14:57 | 9.2K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_practices_treatment_crop_other_ta.html | 2020-11-17 14:57 | 14K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_practices_treatment_crop_pulses_ta.html | 2020-11-17 14:57 | 9.0K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_practices_treatment_crop_ta.html | 2020-11-17 14:58 | 6.3K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_practices_treatment_crop_veg_ta.html | 2020-11-17 14:57 | 23K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_practices_treatment_general_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_practices_treatment_intro_ta.html | 2020-11-17 14:57 | 9.4K | |
![[TXT]](/icons/text.gif) | orgfarm_farming_practices_treatment_ta.html | 2020-11-17 14:57 | 6.0K | |
![[TXT]](/icons/text.gif) | orgfarm_ferti_mannure_ta.html | 2024-07-09 14:35 | 5.6K | |
![[TXT]](/icons/text.gif) | orgfarm_french beans.html | 2020-11-17 14:58 | 19K | |
![[TXT]](/icons/text.gif) | orgfarm_frenchbeans_ta.html | 2020-11-17 14:57 | 16K | |
![[TXT]](/icons/text.gif) | orgfarm_fruits.html | 2020-11-17 14:57 | 38K | |
![[TXT]](/icons/text.gif) | orgfarm_fruits_ta.html | 2020-11-17 14:57 | 42K | |
![[TXT]](/icons/text.gif) | orgfarm_gallery_ta.html | 2020-11-17 14:58 | 9.9K | |
![[TXT]](/icons/text.gif) | orgfarm_garlic.html | 2020-11-17 14:57 | 20K | |
![[TXT]](/icons/text.gif) | orgfarm_garlic_ta.html | 2020-11-17 14:58 | 16K | |
![[TXT]](/icons/text.gif) | orgfarm_gerbara_ta.html | 2020-11-17 14:58 | 16K | |
![[TXT]](/icons/text.gif) | orgfarm_gerbera.html | 2020-11-17 14:57 | 20K | |
![[TXT]](/icons/text.gif) | orgfarm_ginger.html | 2020-11-17 14:57 | 22K | |
![[TXT]](/icons/text.gif) | orgfarm_ginger_ta.html | 2020-11-17 14:57 | 20K | |
![[TXT]](/icons/text.gif) | orgfarm_green leaf manure.html | 2020-11-17 14:57 | 20K | |
![[IMG]](/icons/image2.gif) | orgfarm_green leaf manure_clip_image002.jpg | 2020-11-17 14:57 | 59K | |
![[TXT]](/icons/text.gif) | orgfarm_green leaf manure_ta.html | 2020-11-17 14:58 | 19K | |
![[TXT]](/icons/text.gif) | orgfarm_green manure.html | 2020-11-17 14:57 | 19K | |
![[IMG]](/icons/image2.gif) | orgfarm_green manure_clip_image002.jpg | 2020-11-17 14:57 | 23K | |
![[TXT]](/icons/text.gif) | orgfarm_green manure_ta.html | 2024-06-25 14:44 | 24K | |
![[TXT]](/icons/text.gif) | orgfarm_hortidiseases.html | 2020-11-17 14:57 | 123K | |
![[IMG]](/icons/image2.gif) | orgfarm_hortidiseases_clip_image001.gif | 2020-11-17 14:57 | 73 | |
![[IMG]](/icons/image2.gif) | orgfarm_hortidiseases_clip_image001.jpg | 2020-11-17 14:58 | 608 | |
![[IMG]](/icons/image2.gif) | orgfarm_hortidiseases_clip_image002.jpg | 2020-11-17 14:57 | 27K | |
![[IMG]](/icons/image2.gif) | orgfarm_hortidiseases_clip_image002_0000.jpg | 2020-11-17 14:57 | 14K | |
![[TXT]](/icons/text.gif) | orgfarm_hortidiseases_ta.html | 2020-11-17 14:57 | 288K | |
![[TXT]](/icons/text.gif) | orgfarm_hortipest.html | 2020-11-17 14:58 | 19K | |
![[TXT]](/icons/text.gif) | orgfarm_hortipest_ta.html | 2020-11-17 14:57 | 8.6K | |
![[TXT]](/icons/text.gif) | orgfarm_importers.html | 2020-11-17 14:58 | 25K | |
![[TXT]](/icons/text.gif) | orgfarm_importers_ta.html | 2020-11-17 14:57 | 25K | |
![[TXT]](/icons/text.gif) | orgfarm_index - agrindex.html | 2020-11-17 14:57 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_index - agrindex_ta.html | 2020-11-17 14:57 | 4.9K | |
![[TXT]](/icons/text.gif) | orgfarm_index - hortiindex.html | 2020-11-17 14:57 | 15K | |
![[TXT]](/icons/text.gif) | orgfarm_index - hortiindex_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_index.html | 2020-11-17 14:57 | 13K | |
![[IMG]](/icons/image2.gif) | orgfarm_index01.jpg | 2020-11-17 14:57 | 6.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_index_center.jpg | 2020-11-17 14:58 | 238K | |
![[TXT]](/icons/text.gif) | orgfarm_index_ta.htm | 2020-11-17 14:57 | 9.3K | |
![[TXT]](/icons/text.gif) | orgfarm_index_ta.html | 2025-01-24 12:24 | 16K | |
![[TXT]](/icons/text.gif) | orgfarm_index_ta01.html | 2020-11-17 14:57 | 6.5K | |
![[DIR]](/icons/folder.gif) | orgfarm_index_ta_files/ | 2020-11-18 11:21 | - | |
![[TXT]](/icons/text.gif) | orgfarm_inputs_tech_ta.html | 2020-11-17 14:58 | 7.4K | |
![[TXT]](/icons/text.gif) | orgfarm_introduction.html | 2020-11-17 14:58 | 18K | |
![[IMG]](/icons/image2.gif) | orgfarm_introduction_clip_image001.gif | 2020-11-17 14:57 | 1.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_introduction_clip_image001_0000.gif | 2020-11-17 14:57 | 1.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_introduction_clip_image001_0001.gif | 2020-11-17 14:57 | 1.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_introduction_clip_image001_0002.gif | 2020-11-17 14:57 | 1.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_introduction_clip_image001_0003.gif | 2020-11-17 14:57 | 1.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_introduction_clip_image001_0004.gif | 2020-11-17 14:58 | 1.0K | |
![[TXT]](/icons/text.gif) | orgfarm_introduction_ta.html | 2020-11-17 14:57 | 12K | |
![[TXT]](/icons/text.gif) | orgfarm_manure.html | 2020-11-17 14:57 | 33K | |
![[IMG]](/icons/image2.gif) | orgfarm_manure_clip_image002.jpg | 2020-11-17 14:57 | 11K | |
![[IMG]](/icons/image2.gif) | orgfarm_manure_clip_image004.jpg | 2020-11-17 14:58 | 11K | |
![[IMG]](/icons/image2.gif) | orgfarm_manure_clip_image006.jpg | 2020-11-17 14:57 | 21K | |
![[IMG]](/icons/image2.gif) | orgfarm_manure_clip_image008.jpg | 2020-11-17 14:58 | 37K | |
![[TXT]](/icons/text.gif) | orgfarm_manure_ta.html | 2024-06-25 14:44 | 38K | |
![[TXT]](/icons/text.gif) | orgfarm_marketing_ta.html | 2024-07-09 14:35 | 70K | |
![[TXT]](/icons/text.gif) | orgfarm_miscellaneous.html | 2020-11-17 14:57 | 42K | |
![[IMG]](/icons/image2.gif) | orgfarm_miscellaneous_clip_image002.jpg | 2020-11-17 14:58 | 4.1K | |
![[TXT]](/icons/text.gif) | orgfarm_miscellaneous_ta.html | 2020-11-17 14:57 | 4.0K | |
![[TXT]](/icons/text.gif) | orgfarm_nutientmgt.html | 2020-11-17 14:57 | 16K | |
![[TXT]](/icons/text.gif) | orgfarm_nutientmgt_ta.html | 2020-11-17 14:57 | 12K | |
![[TXT]](/icons/text.gif) | orgfarm_oc agencies.html | 2020-11-17 14:57 | 21K | |
![[TXT]](/icons/text.gif) | orgfarm_oc agencies_ta.html | 2020-11-17 14:57 | 14K | |
![[TXT]](/icons/text.gif) | orgfarm_oc certification.html | 2020-11-17 14:58 | 32K | |
![[TXT]](/icons/text.gif) | orgfarm_oc guidelines.html | 2020-11-17 14:58 | 31K | |
![[TXT]](/icons/text.gif) | orgfarm_oc guidelines_ta.html | 2020-11-17 14:57 | 32K | |
![[TXT]](/icons/text.gif) | orgfarm_oc procedure.html | 2020-11-17 14:57 | 14K | |
![[TXT]](/icons/text.gif) | orgfarm_oc procedure_ta.html | 2020-11-17 14:57 | 5.9K | |
![[TXT]](/icons/text.gif) | orgfarm_of_vs_con_fasrming_ta.html | 2020-11-17 14:58 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_ofk_impact_ta.html | 2024-06-22 12:46 | 14K | |
![[TXT]](/icons/text.gif) | orgfarm_ofk_intro_ta.html | 2024-06-22 12:46 | 21K | |
![[TXT]](/icons/text.gif) | orgfarm_ofk_material_ta.html | 2024-06-22 12:46 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_ofk_method_ta.html | 2020-11-17 14:58 | 8.0K | |
![[TXT]](/icons/text.gif) | orgfarm_ofk_nutrient_ta.html | 2024-06-22 12:46 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_ofk_pltcare_ta.html | 2024-06-22 12:46 | 9.6K | |
![[TXT]](/icons/text.gif) | orgfarm_ofk_pltprotection_ta.html | 2024-06-22 12:46 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_ofk_soil_ta.html | 2024-06-22 12:46 | 28K | |
![[TXT]](/icons/text.gif) | orgfarm_ofk_swot_ta.html | 2024-06-22 12:46 | 8.0K | |
![[TXT]](/icons/text.gif) | orgfarm_ofk_ta.html | 2024-06-22 12:46 | 7.6K | |
![[TXT]](/icons/text.gif) | orgfarm_of vs con fasrming.html | 2020-11-17 14:57 | 25K | |
![[TXT]](/icons/text.gif) | orgfarm_of vs con fasrming_ta.html | 2020-11-17 14:57 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_panchakavya.html | 2020-11-17 14:57 | 48K | |
![[TXT]](/icons/text.gif) | orgfarm_panchakavya_ta.html | 2024-06-25 14:44 | 58K | |
![[TXT]](/icons/text.gif) | orgfarm_pepper.html | 2020-11-17 14:58 | 24K | |
![[TXT]](/icons/text.gif) | orgfarm_pepper_ta.html | 2020-11-17 14:57 | 23K | |
![[TXT]](/icons/text.gif) | orgfarm_pest_agronomicpractice_ta.html | 2020-11-17 14:57 | 26K | |
![[TXT]](/icons/text.gif) | orgfarm_pest_biologicalcontrol_ta.html | 2020-11-17 14:57 | 30K | |
![[TXT]](/icons/text.gif) | orgfarm_pest_biopesticides_ta.html | 2020-11-17 14:57 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_pest_intro_ta.html | 2020-11-17 14:57 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_pest_mechanicalmethod_ta.html | 2020-11-17 14:57 | 24K | |
![[TXT]](/icons/text.gif) | orgfarm_pest_organicpesticides_ta.html | 2020-11-17 14:57 | 17K | |
![[TXT]](/icons/text.gif) | orgfarm_pest_photogal1_ta.html | 2020-11-17 14:58 | 6.6K | |
![[TXT]](/icons/text.gif) | orgfarm_pest_photogal2_ta.html | 2020-11-17 14:58 | 6.4K | |
![[TXT]](/icons/text.gif) | orgfarm_pest_photogal3_ta.html | 2020-11-17 14:58 | 6.3K | |
![[TXT]](/icons/text.gif) | orgfarm_pest_photogal4_ta.html | 2020-11-17 14:58 | 5.7K | |
![[TXT]](/icons/text.gif) | orgfarm_pest_photogal5_ta.html | 2020-11-17 14:57 | 5.8K | |
![[TXT]](/icons/text.gif) | orgfarm_pht_pestmgt_ta.html | 2024-07-09 14:35 | 23K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_disease_bio_ta.html | 2020-11-17 14:58 | 7.0K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_disease_leaf_ta.html | 2020-11-17 14:57 | 6.1K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_disease_photogal_ta.html | 2020-11-17 14:57 | 15K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_disease_seed_ta.html | 2020-11-17 14:57 | 8.5K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_disease_soil_ta.html | 2020-11-17 14:57 | 15K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_disease_ta.html | 2020-11-17 14:57 | 7.9K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_nematode_1_ta.html | 2020-11-17 14:57 | 18K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_nematode_2_ta.html | 2020-11-17 14:57 | 26K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_nematode_3_ta.html | 2020-11-17 14:57 | 7.0K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_nematode_4_ta.html | 2020-11-17 14:58 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_nematode_intro_ta.html | 2020-11-17 14:57 | 10K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_nematode_ta.html | 2020-11-17 14:58 | 6.9K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_pest_ta.html | 2020-11-17 14:58 | 8.0K | |
![[TXT]](/icons/text.gif) | orgfarm_plant_proctection_ta.html | 2025-02-25 11:00 | 6.6K | |
![[TXT]](/icons/text.gif) | orgfarm_potato.html | 2020-11-17 14:57 | 27K | |
![[TXT]](/icons/text.gif) | orgfarm_potato_ta.html | 2020-11-17 14:58 | 27K | |
![[TXT]](/icons/text.gif) | orgfarm_poultry_ta.html | 2024-06-22 12:28 | 32K | |
![[TXT]](/icons/text.gif) | orgfarm_prac_agri_paddy_bio_ta.html | 2020-11-17 14:57 | 15K | |
![[TXT]](/icons/text.gif) | orgfarm_prac_agri_paddy_climate_ta.html | 2020-11-17 14:57 | 18K | |
![[TXT]](/icons/text.gif) | orgfarm_prac_agri_paddy_cultivation_ta.html | 2020-11-17 14:58 | 19K | |
![[TXT]](/icons/text.gif) | orgfarm_prac_agri_paddy_harvest_ta.html | 2020-11-17 14:58 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_prac_agri_paddy_seed_ta.html | 2020-11-17 14:57 | 18K | |
![[TXT]](/icons/text.gif) | orgfarm_prac_agri_paddy_soil_ta.html | 2020-11-17 14:57 | 9.1K | |
![[TXT]](/icons/text.gif) | orgfarm_prac_agri_paddy_ta.html | 2020-11-17 14:57 | 7.3K | |
![[TXT]](/icons/text.gif) | orgfarm_prac_agri_paddy_water_ta.html | 2020-11-17 14:57 | 9.2K | |
![[TXT]](/icons/text.gif) | orgfarm_practices_groundnut_ta.html | 2020-11-17 14:57 | 23K | |
![[TXT]](/icons/text.gif) | orgfarm_principles.html | 2020-11-17 14:58 | 19K | |
![[TXT]](/icons/text.gif) | orgfarm_principles_ta.html | 2020-11-17 14:57 | 8.7K | |
![[TXT]](/icons/text.gif) | orgfarm_publications.html | 2020-11-17 14:58 | 38K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image002.jpg | 2020-11-17 14:57 | 7.6K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image002_0000.jpg | 2020-11-17 14:58 | 7.6K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image002_0001.jpg | 2020-11-17 14:58 | 5.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image002_0002.jpg | 2020-11-17 14:57 | 5.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image004.jpg | 2020-11-17 14:57 | 9.9K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image004_0000.jpg | 2020-11-17 14:58 | 9.9K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image004_0001.jpg | 2020-11-17 14:58 | 6.1K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image006.gif | 2020-11-17 14:57 | 7.1K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image006.jpg | 2020-11-17 14:57 | 7.6K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image006_0000.gif | 2020-11-17 14:58 | 7.1K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image008.jpg | 2020-11-17 14:57 | 8.7K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image008_0000.jpg | 2020-11-17 14:57 | 8.7K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image008_0001.jpg | 2020-11-17 14:57 | 8.2K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image010.jpg | 2020-11-17 14:57 | 7.4K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image010_0000.jpg | 2020-11-17 14:58 | 7.4K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image010_0001.jpg | 2020-11-17 14:57 | 8.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image011.jpg | 2020-11-17 14:57 | 5.3K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image011_0000.jpg | 2020-11-17 14:58 | 5.3K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image012.jpg | 2020-11-17 14:58 | 11K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image013.jpg | 2020-11-17 14:57 | 5.7K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image013_0000.jpg | 2020-11-17 14:57 | 5.7K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image014.jpg | 2020-11-17 14:58 | 6.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image014_0000.jpg | 2020-11-17 14:57 | 6.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image014_0001.jpg | 2020-11-17 14:57 | 8.3K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image016.jpg | 2020-11-17 14:58 | 5.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image016_0000.jpg | 2020-11-17 14:57 | 5.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image016_0001.jpg | 2020-11-17 14:57 | 3.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image018.jpg | 2020-11-17 14:57 | 6.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image018_0000.jpg | 2020-11-17 14:57 | 6.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image018_0001.jpg | 2020-11-17 14:57 | 8.0K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image020.jpg | 2020-11-17 14:58 | 5.8K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image020_0000.jpg | 2020-11-17 14:57 | 5.8K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image020_0001.jpg | 2020-11-17 14:57 | 8.8K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image022.jpg | 2020-11-17 14:57 | 8.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image022_0000.jpg | 2020-11-17 14:57 | 8.5K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image024.jpg | 2020-11-17 14:57 | 7.9K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image024_0000.jpg | 2020-11-17 14:57 | 7.9K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image026.jpg | 2020-11-17 14:58 | 5.7K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image026_0000.jpg | 2020-11-17 14:57 | 5.7K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image028.jpg | 2020-11-17 14:57 | 6.6K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image028_0000.jpg | 2020-11-17 14:57 | 6.6K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image029.gif | 2020-11-17 14:57 | 7.6K | |
![[IMG]](/icons/image2.gif) | orgfarm_publications_clip_image029_0000.gif | 2020-11-17 14:58 | 7.6K | |
![[TXT]](/icons/text.gif) | orgfarm_publications_ta.html | 2020-11-17 14:57 | 42K | |
![[TXT]](/icons/text.gif) | orgfarm_recycling of farm waste.html | 2020-11-17 14:57 | 22K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image002.jpg | 2020-11-17 14:58 | 36K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image002_0000.jpg | 2020-11-17 14:57 | 36K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image002_0001.jpg | 2020-11-17 14:57 | 23K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image004.jpg | 2020-11-17 14:57 | 36K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image006.jpg | 2020-11-17 14:57 | 17K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image007.gif | 2020-11-17 14:57 | 101 | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image007_0000.gif | 2020-11-17 14:57 | 101 | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image007_0001.gif | 2020-11-17 14:57 | 101 | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image007_0002.gif | 2020-11-17 14:57 | 101 | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image007_0003.gif | 2020-11-17 14:57 | 101 | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image009.jpg | 2020-11-17 14:58 | 21K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image011.jpg | 2020-11-17 14:57 | 16K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image013.jpg | 2020-11-17 14:57 | 36K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image014.gif | 2020-11-17 14:57 | 102 | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image016.jpg | 2020-11-17 14:58 | 22K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image018.jpg | 2020-11-17 14:57 | 25K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image020.jpg | 2020-11-17 14:57 | 23K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image022.jpg | 2020-11-17 14:58 | 24K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image024.jpg | 2020-11-17 14:58 | 26K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image026.jpg | 2020-11-17 14:57 | 20K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image028.jpg | 2020-11-17 14:57 | 18K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_clip_image030.jpg | 2020-11-17 14:58 | 16K | |
![[TXT]](/icons/text.gif) | orgfarm_recycling of farm waste_ta.html | 2024-06-25 14:34 | 24K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image001.jpg | 2020-11-17 14:57 | 36K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image002.jpg | 2020-11-17 14:57 | 36K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image003.jpg | 2020-11-17 14:58 | 17K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image004.gif | 2020-11-17 14:57 | 226 | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image004_0000.gif | 2020-11-17 14:57 | 226 | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image004_0001.gif | 2020-11-17 14:58 | 226 | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image004_0002.gif | 2020-11-17 14:57 | 226 | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image004_0003.gif | 2020-11-17 14:57 | 226 | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image005.jpg | 2020-11-17 14:57 | 21K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image006.jpg | 2020-11-17 14:58 | 16K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image007.jpg | 2020-11-17 14:57 | 36K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image008.gif | 2020-11-17 14:57 | 226 | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image009.jpg | 2020-11-17 14:57 | 22K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image010.jpg | 2020-11-17 14:58 | 25K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image011.jpg | 2020-11-17 14:57 | 24K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image012.jpg | 2020-11-17 14:57 | 26K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image013.jpg | 2020-11-17 14:57 | 20K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image014.jpg | 2020-11-17 14:58 | 18K | |
![[IMG]](/icons/image2.gif) | orgfarm_recycling of farm waste_ta_clip_image015.jpg | 2020-11-17 14:58 | 16K | |
![[TXT]](/icons/text.gif) | orgfarm_relatedinfo_ciks_ta.html | 2020-11-17 14:57 | 5.1K | |
![[TXT]](/icons/text.gif) | orgfarm_relatedinfo_ta.html | 2024-07-09 14:35 | 4.9K | |
![[TXT]](/icons/text.gif) | orgfarm_related websites.html | 2020-11-17 14:57 | 42K | |
![[TXT]](/icons/text.gif) | orgfarm_related websites_ta.html | 2020-11-17 14:58 | 9.6K | |
![[TXT]](/icons/text.gif) | orgfarm_relatedwebsites_ta.html | 2024-07-09 14:35 | 24K | |
![[TXT]](/icons/text.gif) | orgfarm_rosemary.html | 2020-11-17 14:57 | 18K | |
![[TXT]](/icons/text.gif) | orgfarm_rosemery_ta.html | 2020-11-17 14:57 | 14K | |
![[TXT]](/icons/text.gif) | orgfarm_safal_benefits_ta.html | 2024-06-22 12:28 | 8.1K | |
![[TXT]](/icons/text.gif) | orgfarm_safal_compost_ta.html | 2024-06-22 12:28 | 8.5K | |
![[TXT]](/icons/text.gif) | orgfarm_safal_intro_ta.html | 2024-06-22 12:28 | 11K | |
![[TXT]](/icons/text.gif) | orgfarm_safal_materials_ta.html | 2024-06-22 12:28 | 24K | |
![[TXT]](/icons/text.gif) | orgfarm_safal_ta.html | 2024-06-22 12:28 | 6.1K | |
![[TXT]](/icons/text.gif) | orgfarm_scenario.html | 2020-11-17 14:57 | 17K | |
![[TXT]](/icons/text.gif) | orgfarm_schems.html | 2020-11-17 14:57 | 30K | |
![[TXT]](/icons/text.gif) | orgfarm_schems_ta.html | 2020-11-17 14:57 | 29K | |
![[TXT]](/icons/text.gif) | orgfarm_spl_input_success_ta.html | 2020-11-17 14:57 | 32K | |
![[TXT]](/icons/text.gif) | orgfarm_spl_input_ta.html | 2024-06-25 14:44 | 5.3K | |
![[TXT]](/icons/text.gif) | orgfarm_stores in TN.html | 2020-11-17 14:57 | 14K | |
![[TXT]](/icons/text.gif) | orgfarm_stores in TN_ta.html | 2020-11-17 14:58 | 13K | |
![[TXT]](/icons/text.gif) | orgfarm_successful organic transition.html | 2020-11-17 14:57 | 26K | |
![[TXT]](/icons/text.gif) | orgfarm_successful organic transition_ta.html | 2020-11-17 14:57 | 19K | |
![[TXT]](/icons/text.gif) | orgfarm_success stories.html | 2020-11-17 14:57 | 39K | |
![[TXT]](/icons/text.gif) | orgfarm_success stories_ss7_ta.html | 2020-11-17 14:57 | 29K | |
![[TXT]](/icons/text.gif) | orgfarm_success stories_ta.html | 2020-11-17 14:57 | 52K | |
![[TXT]](/icons/text.gif) | orgfarm_sugar_ta.html | 2024-06-22 12:28 | 18K | |
![[TXT]](/icons/text.gif) | orgfarm_sugarcane.html | 2020-11-17 14:58 | 21K | |
![[IMG]](/icons/image2.gif) | orgfarm_sugarcane_clip_image001.gif | 2020-11-17 14:57 | 5.2K | |
![[TXT]](/icons/text.gif) | orgfarm_sugarcane_ta.html | 2020-11-17 14:58 | 21K | |
![[TXT]](/icons/text.gif) | orgfarm_thyme.html | 2020-11-17 14:57 | 17K | |
![[TXT]](/icons/text.gif) | orgfarm_thyme_ta.html | 2020-11-17 14:57 | 12K | |
![[TXT]](/icons/text.gif) | orgfarm_tips_ta.html | 2020-11-17 14:58 | 62K | |
![[TXT]](/icons/text.gif) | orgfarm_trainings.html | 2020-11-17 14:58 | 15K | |
![[TXT]](/icons/text.gif) | orgfarm_trainings_ta.html | 2024-11-12 12:15 | 7.1K | |
![[TXT]](/icons/text.gif) | orgfarm_vanilla.html | 2020-11-17 14:57 | 20K | |
![[TXT]](/icons/text.gif) | orgfarm_vanilla_ta.html | 2020-11-17 14:57 | 16K | |
![[TXT]](/icons/text.gif) | orgfarm_vermicompost.html | 2020-11-17 14:57 | 62K | |
![[TXT]](/icons/text.gif) | orgfarm_vermicompost_bamboo_ta.html | 2020-11-17 14:58 | 7.6K | |
![[TXT]](/icons/text.gif) | orgfarm_vermicompost_ta.html | 2024-06-22 12:28 | 45K | |
![[TXT]](/icons/text.gif) | orgfarm_video_ta.html | 2020-11-17 14:57 | 9.3K | |
![[TXT]](/icons/text.gif) | orgfarm_video_v1_ta.html | 2020-11-17 14:57 | 3.8K | |
![[TXT]](/icons/text.gif) | orgfarm_video_v2_ta.html | 2020-11-17 14:57 | 3.7K | |
![[TXT]](/icons/text.gif) | orgfarm_video_v3_ta.html | 2020-11-17 14:58 | 3.8K | |
![[TXT]](/icons/text.gif) | orgfarm_video_v4_ta.html | 2020-11-17 14:58 | 3.9K | |
![[TXT]](/icons/text.gif) | orgfarm_video_v5_ta.html | 2020-11-17 14:57 | 3.8K | |
![[TXT]](/icons/text.gif) | orgfarm_video_v6_ta.html | 2020-11-17 14:57 | 3.7K | |
![[TXT]](/icons/text.gif) | orgfarm_video_v7_ta.html | 2020-11-17 14:57 | 3.7K | |
![[TXT]](/icons/text.gif) | orgfarm_video_v8_ta.html | 2020-11-17 14:57 | 3.7K | |
![[TXT]](/icons/text.gif) | orgfarm_weed mgt.html | 2020-11-17 14:57 | 50K | |
![[TXT]](/icons/text.gif) | orgfarm_weed mgt_ta.html | 2020-11-17 14:58 | 9.8K | |
![[TXT]](/icons/text.gif) | orgfarm_weedmgt_ta.html | 2020-11-17 14:57 | 45K | |
![[IMG]](/icons/image2.gif) | orgfarm_weedmgt_ta_clip_image002.jpg | 2020-11-17 14:57 | 24K | |
![[IMG]](/icons/image2.gif) | orgfarm_weedmgt_ta_clip_image003.jpg | 2020-11-17 14:57 | 48K | |
![[TXT]](/icons/text.gif) | orgfarm_zerobudget_ta.html | 2020-11-17 14:57 | 43K | |
![[IMG]](/icons/image2.gif) | panchakavya.jpg | 2020-11-17 14:57 | 2.6M | |
![[IMG]](/icons/image2.gif) | panchakavya tamil.jpg | 2020-11-17 14:57 | 2.8M | |
![[DIR]](/icons/folder.gif) | pdf/ | 2025-04-01 09:08 | - | |
![[IMG]](/icons/image2.gif) | polyethene mulches.jpg | 2020-11-17 14:57 | 51K | |
![[IMG]](/icons/image2.gif) | portulaca.jpg | 2020-11-17 14:58 | 36K | |
![[IMG]](/icons/image2.gif) | poultry waste.jpg | 2020-11-17 14:58 | 368K | |
![[IMG]](/icons/image2.gif) | powdery mildew-rose.jpg | 2020-11-17 14:57 | 37K | |
![[IMG]](/icons/image2.gif) | principles of organic farming.jpg | 2020-11-17 14:57 | 91K | |
![[IMG]](/icons/image2.gif) | rose-black-spot.jpg | 2020-11-17 14:57 | 78K | |
![[IMG]](/icons/image2.gif) | shed.jpg | 2020-11-17 14:57 | 23K | |
![[IMG]](/icons/image2.gif) | soil solarisation.jpg | 2020-11-17 14:57 | 31K | |
![[IMG]](/icons/image2.gif) | successful transition table.JPG | 2020-11-17 14:57 | 25K | |
![[IMG]](/icons/image2.gif) | table copy.jpg | 2020-11-17 14:57 | 143K | |
![[IMG]](/icons/image2.gif) | tlc.jpg | 2020-11-17 14:58 | 80K | |
![[IMG]](/icons/image2.gif) | tomato damping off.jpg | 2020-11-17 14:57 | 40K | |
![[IMG]](/icons/image2.gif) | tomato damping off fruits.jpg | 2020-11-17 14:57 | 40K | |
![[IMG]](/icons/image2.gif) | untitled.JPG | 2020-11-17 14:58 | 66K | |
![[ ]](/icons/unknown.gif) | untitled1212 | 2020-11-17 14:57 | 10K | |
![[IMG]](/icons/image2.gif) | vermicompost.jpg | 2020-11-17 14:57 | 24K | |
![[ ]](/icons/layout.gif) | vermicompost.pdf | 2020-11-17 14:58 | 2.3M | |
![[DIR]](/icons/folder.gif) | video/ | 2020-11-18 11:21 | - | |
![[IMG]](/icons/image2.gif) | we.JPG | 2020-11-17 14:57 | 17K | |
![[IMG]](/icons/image2.gif) | xanthomonas-campestris-02.jpg | 2020-11-17 14:57 | 102K | |
|